C33H47F2N3O10S — CID 160657816
(E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propylsulfonyl]phenoxy]phenyl]-2-methylprop-2-enamide (PubChem CID 160657816) has the molecular formula C33H47F2N3O10S and a molecular weight of 715.81 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propylsulfonyl]phenoxy]phenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propylsulfonyl]phenoxy]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 160657816 |
| Molecular Formula | C33H47F2N3O10S |
| Molecular Weight | 715.81 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propylsulfonyl]phenoxy]phenyl]-2-methylprop-2-enamide |
| SMILES | CCCOCCOCCOCCOCCOCCOCCCS(=O)(=O)c1ccc(Oc2c(F)cc(/C=C(\C)C(=O)N=C(N)N)cc2F)cc1 |
| InChI | InChI=1S/C33H47F2N3O10S/c1-3-9-42-11-13-44-15-17-46-19-20-47-18-16-45-14-12-43-10-4-21-49(40,41)28-7-5-27(6-8-28)48-31-29(34)23-26(24-30(31)35)22-25(2)32(39)38-33(36)37/h5-8,22-24H,3-4,9-21H2,1-2H3,(H4,36,37,38,39)/b25-22+ |
| InChIKey | MPQRZHSIVPRLOA-YYDJUVGSSA-N |
| XLogP | 3.63 |
| TPSA | 180.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|