C23H29F2N5O6S — CID 67454355
(E)-3-[4-[4-[2-[2-(2-aminoethoxy)ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide (PubChem CID 67454355) has the molecular formula C23H29F2N5O6S and a molecular weight of 541.58 g/mol. Its IUPAC name is (E)-3-[4-[4-[2-[2-(2-aminoethoxy)ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide.
| Compound Name | (E)-3-[4-[4-[2-[2-(2-aminoethoxy)ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 67454355 |
| Molecular Formula | C23H29F2N5O6S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (E)-3-[4-[4-[2-[2-(2-aminoethoxy)ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)NCCOCCOCCN)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C23H29F2N5O6S/c1-15(22(31)30-23(27)28)12-16-13-19(24)21(20(25)14-16)36-17-2-4-18(5-3-17)37(32,33)29-7-9-35-11-10-34-8-6-26/h2-5,12-14,29H,6-11,26H2,1H3,(H4,27,28,30,31)/b15-12+ |
| InChIKey | GZKOXHLNXHHIFA-NTCAYCPXSA-N |
| XLogP | 1.23 |
| TPSA | 181.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|