C20H23FN4O4S — CID 163648083
(E)-N-(diaminomethylidene)-3-[4-[4-(ethylsulfamoyl)phenoxy]-3-fluoro-5-methylphenyl]-2-methylprop-2-enamide (PubChem CID 163648083) has the molecular formula C20H23FN4O4S and a molecular weight of 434.49 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-3-[4-[4-(ethylsulfamoyl)phenoxy]-3-fluoro-5-methylphenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-3-[4-[4-(ethylsulfamoyl)phenoxy]-3-fluoro-5-methylphenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 163648083 |
| Molecular Formula | C20H23FN4O4S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (E)-N-(diaminomethylidene)-3-[4-[4-(ethylsulfamoyl)phenoxy]-3-fluoro-5-methylphenyl]-2-methylprop-2-enamide |
| SMILES | CCNS(=O)(=O)c1ccc(Oc2c(C)cc(/C=C(\C)C(=O)N=C(N)N)cc2F)cc1 |
| InChI | InChI=1S/C20H23FN4O4S/c1-4-24-30(27,28)16-7-5-15(6-8-16)29-18-12(2)9-14(11-17(18)21)10-13(3)19(26)25-20(22)23/h5-11,24H,4H2,1-3H3,(H4,22,23,25,26)/b13-10+ |
| InChIKey | IJYRGUGGOWMFIL-JLHYYAGUSA-N |
| XLogP | 2.43 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|