C21H20F2N4O8S — CID 67456225
2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]butanedioic acid (PubChem CID 67456225) has the molecular formula C21H20F2N4O8S and a molecular weight of 526.47 g/mol. Its IUPAC name is 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]butanedioic acid.
| Compound Name | 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 67456225 |
| Molecular Formula | C21H20F2N4O8S |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]butanedioic acid |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)NC(CC(=O)O)C(=O)O)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C21H20F2N4O8S/c1-10(19(30)26-21(24)25)6-11-7-14(22)18(15(23)8-11)35-12-2-4-13(5-3-12)36(33,34)27-16(20(31)32)9-17(28)29/h2-8,16,27H,9H2,1H3,(H,28,29)(H,31,32)(H4,24,25,26,30)/b10-6+ |
| InChIKey | OBQYONNQTNKCIX-UXBLZVDNSA-N |
| XLogP | 1.17 |
| TPSA | 211.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|