C25H25F2N4O7PS — CID 70872118
[4-[[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]methyl]phenyl]methylphosphonic acid (PubChem CID 70872118) has the molecular formula C25H25F2N4O7PS and a molecular weight of 594.53 g/mol. Its IUPAC name is [4-[[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]methyl]phenyl]methylphosphonic acid.
| Compound Name | [4-[[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]methyl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 70872118 |
| Molecular Formula | C25H25F2N4O7PS |
| Molecular Weight | 594.53 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | [4-[[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]methyl]phenyl]methylphosphonic acid |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)NCc3ccc(CP(=O)(O)O)cc3)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C25H25F2N4O7PS/c1-15(24(32)31-25(28)29)10-18-11-21(26)23(22(27)12-18)38-19-6-8-20(9-7-19)40(36,37)30-13-16-2-4-17(5-3-16)14-39(33,34)35/h2-12,30H,13-14H2,1H3,(H2,33,34,35)(H4,28,29,31,32)/b15-10+ |
| InChIKey | FSQZPIBCHORXKN-XNTDXEJSSA-N |
| XLogP | 3.12 |
| TPSA | 194.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|