C28H30F2NO8PS — CID 123830855
3-[4-[4-[[4-(diethoxyphosphorylmethyl)phenyl]methylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoic acid (PubChem CID 123830855) has the molecular formula C28H30F2NO8PS and a molecular weight of 609.58 g/mol. Its IUPAC name is 3-[4-[4-[[4-(diethoxyphosphorylmethyl)phenyl]methylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[4-[4-[[4-(diethoxyphosphorylmethyl)phenyl]methylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 123830855 |
| Molecular Formula | C28H30F2NO8PS |
| Molecular Weight | 609.58 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | 3-[4-[4-[[4-(diethoxyphosphorylmethyl)phenyl]methylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoic acid |
| SMILES | CCOP(=O)(Cc1ccc(CNS(=O)(=O)c2ccc(Oc3c(F)cc(C=C(C)C(=O)O)cc3F)cc2)cc1)OCC |
| InChI | InChI=1S/C28H30F2NO8PS/c1-4-37-40(34,38-5-2)18-21-8-6-20(7-9-21)17-31-41(35,36)24-12-10-23(11-13-24)39-27-25(29)15-22(16-26(27)30)14-19(3)28(32)33/h6-16,31H,4-5,17-18H2,1-3H3,(H,32,33) |
| InChIKey | SHNKENXMPCPESM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.58 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|