C28H36F2N2O9S — CID 163489749
ethyl (E)-3-[4-[4-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate (PubChem CID 163489749) has the molecular formula C28H36F2N2O9S and a molecular weight of 614.66 g/mol. Its IUPAC name is ethyl (E)-3-[4-[4-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[4-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163489749 |
| Molecular Formula | C28H36F2N2O9S |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | ethyl (E)-3-[4-[4-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1cc(F)c(Oc2ccc(S(=O)(=O)NCCOCCOCCOCCNC(C)=O)cc2)c(F)c1 |
| InChI | InChI=1S/C28H36F2N2O9S/c1-4-40-28(34)20(2)17-22-18-25(29)27(26(30)19-22)41-23-5-7-24(8-6-23)42(35,36)32-10-12-38-14-16-39-15-13-37-11-9-31-21(3)33/h5-8,17-19,32H,4,9-16H2,1-3H3,(H,31,33)/b20-17+ |
| InChIKey | CLOLXJIGPHEOAP-LVZFUZTISA-N |
| XLogP | 3.19 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|