C18H15ClF2O5S — CID 91074155
ethyl 3-[4-(4-chlorosulfonylphenoxy)-3,5-difluorophenyl]-2-methylprop-2-enoate (PubChem CID 91074155) has the molecular formula C18H15ClF2O5S and a molecular weight of 416.83 g/mol. Its IUPAC name is ethyl 3-[4-(4-chlorosulfonylphenoxy)-3,5-difluorophenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl 3-[4-(4-chlorosulfonylphenoxy)-3,5-difluorophenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91074155 |
| Molecular Formula | C18H15ClF2O5S |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | ethyl 3-[4-(4-chlorosulfonylphenoxy)-3,5-difluorophenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C(C)=Cc1cc(F)c(Oc2ccc(S(=O)(=O)Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C18H15ClF2O5S/c1-3-25-18(22)11(2)8-12-9-15(20)17(16(21)10-12)26-13-4-6-14(7-5-13)27(19,23)24/h4-10H,3H2,1-2H3 |
| InChIKey | FIMVUNWQMFEVMA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|