C16H13F2NO5S — CID 67455504
3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoic acid (PubChem CID 67455504) has the molecular formula C16H13F2NO5S and a molecular weight of 369.35 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67455504 |
| Molecular Formula | C16H13F2NO5S |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 3-[3,5-difluoro-4-(4-sulfamoylphenoxy)phenyl]-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1cc(F)c(Oc2ccc(S(N)(=O)=O)cc2)c(F)c1)C(=O)O |
| InChI | InChI=1S/C16H13F2NO5S/c1-9(16(20)21)6-10-7-13(17)15(14(18)8-10)24-11-2-4-12(5-3-11)25(19,22)23/h2-8H,1H3,(H,20,21)(H2,19,22,23) |
| InChIKey | AJLXSDPYLIODDX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|