C22H26F2N2O5S — CID 59893514
ethyl (E)-3-[4-[4-[2-(dimethylamino)ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate (PubChem CID 59893514) has the molecular formula C22H26F2N2O5S and a molecular weight of 468.52 g/mol. Its IUPAC name is ethyl (E)-3-[4-[4-[2-(dimethylamino)ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[4-[2-(dimethylamino)ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59893514 |
| Molecular Formula | C22H26F2N2O5S |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | ethyl (E)-3-[4-[4-[2-(dimethylamino)ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1cc(F)c(Oc2ccc(S(=O)(=O)NCCN(C)C)cc2)c(F)c1 |
| InChI | InChI=1S/C22H26F2N2O5S/c1-5-30-22(27)15(2)12-16-13-19(23)21(20(24)14-16)31-17-6-8-18(9-7-17)32(28,29)25-10-11-26(3)4/h6-9,12-14,25H,5,10-11H2,1-4H3/b15-12+ |
| InChIKey | IAWMIEVWYWZLJB-NTCAYCPXSA-N |
| XLogP | 3.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|