C25H32FNO8S — CID 118011683
ethyl (E)-3-[3-fluoro-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfamoyl]phenoxy]phenyl]-2-methylprop-2-enoate (PubChem CID 118011683) has the molecular formula C25H32FNO8S and a molecular weight of 525.60 g/mol. Its IUPAC name is ethyl (E)-3-[3-fluoro-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfamoyl]phenoxy]phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[3-fluoro-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfamoyl]phenoxy]phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118011683 |
| Molecular Formula | C25H32FNO8S |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | ethyl (E)-3-[3-fluoro-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfamoyl]phenoxy]phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1ccc(Oc2ccc(S(=O)(=O)NCCOCCOCCOC)cc2)c(F)c1 |
| InChI | InChI=1S/C25H32FNO8S/c1-4-34-25(28)19(2)17-20-5-10-24(23(26)18-20)35-21-6-8-22(9-7-21)36(29,30)27-11-12-32-15-16-33-14-13-31-3/h5-10,17-18,27H,4,11-16H2,1-3H3/b19-17+ |
| InChIKey | GOPMBMKLPFHHMT-HTXNQAPBSA-N |
| XLogP | 3.54 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|