C34H48F2N2O12S — CID 167041738
ethyl (E)-3-[4-[4-[2-[2-[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate (PubChem CID 167041738) has the molecular formula C34H48F2N2O12S and a molecular weight of 746.82 g/mol. Its IUPAC name is ethyl (E)-3-[4-[4-[2-[2-[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[4-[2-[2-[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167041738 |
| Molecular Formula | C34H48F2N2O12S |
| Molecular Weight | 746.82 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | ethyl (E)-3-[4-[4-[2-[2-[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1cc(F)c(Oc2ccc(S(=O)(=O)NCCOCCOCCOCCOCCOCCOCCNC(C)=O)cc2)c(F)c1 |
| InChI | InChI=1S/C34H48F2N2O12S/c1-4-49-34(40)26(2)23-28-24-31(35)33(32(36)25-28)50-29-5-7-30(8-6-29)51(41,42)38-10-12-44-14-16-46-18-20-48-22-21-47-19-17-45-15-13-43-11-9-37-27(3)39/h5-8,23-25,38H,4,9-22H2,1-3H3,(H,37,39)/b26-23+ |
| InChIKey | ZZCVATPLABQVBM-WNAAXNPUSA-N |
| XLogP | 3.24 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|