C14H7BrF3NO — CID 107088864
4-[4-(bromomethyl)-2,6-difluorophenoxy]-2-fluorobenzonitrile (PubChem CID 107088864) has the molecular formula C14H7BrF3NO and a molecular weight of 342.11 g/mol. Its IUPAC name is 4-[4-(bromomethyl)-2,6-difluorophenoxy]-2-fluorobenzonitrile.
| Compound Name | 4-[4-(bromomethyl)-2,6-difluorophenoxy]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107088864 |
| Molecular Formula | C14H7BrF3NO |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 4-[4-(bromomethyl)-2,6-difluorophenoxy]-2-fluorobenzonitrile |
| SMILES | N#Cc1ccc(Oc2c(F)cc(CBr)cc2F)cc1F |
| InChI | InChI=1S/C14H7BrF3NO/c15-6-8-3-12(17)14(13(18)4-8)20-10-2-1-9(7-19)11(16)5-10/h1-5H,6H2 |
| InChIKey | FZUTZIRUJJLFOY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|