C15H10BrF2NO2 — CID 107089455
3-[4-(bromomethyl)-2,6-difluorophenoxy]-5-methoxybenzonitrile (PubChem CID 107089455) has the molecular formula C15H10BrF2NO2 and a molecular weight of 354.15 g/mol. Its IUPAC name is 3-[4-(bromomethyl)-2,6-difluorophenoxy]-5-methoxybenzonitrile.
| Compound Name | 3-[4-(bromomethyl)-2,6-difluorophenoxy]-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 107089455 |
| Molecular Formula | C15H10BrF2NO2 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 3-[4-(bromomethyl)-2,6-difluorophenoxy]-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(Oc2c(F)cc(CBr)cc2F)c1 |
| InChI | InChI=1S/C15H10BrF2NO2/c1-20-11-2-10(8-19)3-12(6-11)21-15-13(17)4-9(7-16)5-14(15)18/h2-6H,7H2,1H3 |
| InChIKey | LYSIXRSMAVCXEJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|