C13H7Br2F3O — CID 107088900
2-(3-bromo-5-fluorophenoxy)-5-(bromomethyl)-1,3-difluorobenzene (PubChem CID 107088900) has the molecular formula C13H7Br2F3O and a molecular weight of 396.00 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenoxy)-5-(bromomethyl)-1,3-difluorobenzene.
| Compound Name | 2-(3-bromo-5-fluorophenoxy)-5-(bromomethyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 107088900 |
| Molecular Formula | C13H7Br2F3O |
| Molecular Weight | 396.00 g/mol |
| Exact Mass | 393.88 |
| IUPAC Name | 2-(3-bromo-5-fluorophenoxy)-5-(bromomethyl)-1,3-difluorobenzene |
| SMILES | Fc1cc(Br)cc(Oc2c(F)cc(CBr)cc2F)c1 |
| InChI | InChI=1S/C13H7Br2F3O/c14-6-7-1-11(17)13(12(18)2-7)19-10-4-8(15)3-9(16)5-10/h1-5H,6H2 |
| InChIKey | KQMRUFGWWCRQDK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.00 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|