C15H14BrFO3 — CID 107087773
1-[4-(bromomethyl)-2-fluorophenoxy]-3,5-dimethoxybenzene (PubChem CID 107087773) has the molecular formula C15H14BrFO3 and a molecular weight of 341.18 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2-fluorophenoxy]-3,5-dimethoxybenzene.
| Compound Name | 1-[4-(bromomethyl)-2-fluorophenoxy]-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 107087773 |
| Molecular Formula | C15H14BrFO3 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 1-[4-(bromomethyl)-2-fluorophenoxy]-3,5-dimethoxybenzene |
| SMILES | COc1cc(OC)cc(Oc2ccc(CBr)cc2F)c1 |
| InChI | InChI=1S/C15H14BrFO3/c1-18-11-6-12(19-2)8-13(7-11)20-15-4-3-10(9-16)5-14(15)17/h3-8H,9H2,1-2H3 |
| InChIKey | UZBTWSQYUMFIBS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|