C15H14BrFO — CID 107087006
1-[4-(bromomethyl)-2-fluorophenoxy]-3,5-dimethylbenzene (PubChem CID 107087006) has the molecular formula C15H14BrFO and a molecular weight of 309.18 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2-fluorophenoxy]-3,5-dimethylbenzene.
| Compound Name | 1-[4-(bromomethyl)-2-fluorophenoxy]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 107087006 |
| Molecular Formula | C15H14BrFO |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1-[4-(bromomethyl)-2-fluorophenoxy]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(Oc2ccc(CBr)cc2F)c1 |
| InChI | InChI=1S/C15H14BrFO/c1-10-5-11(2)7-13(6-10)18-15-4-3-12(9-16)8-14(15)17/h3-8H,9H2,1-2H3 |
| InChIKey | UAMXZWBAKIMXBZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|