About 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane
4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane (PubChem CID 91540857) has the molecular formula C13H18BrFIN
and a molecular weight of 414.10 g/mol. Its IUPAC name is 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane.
Molecular Properties
| Compound Name | 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane |
| PubChem CID | 91540857 |
| Molecular Formula | C13H18BrFIN |
| Molecular Weight | 414.10 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane |
| SMILES | CC.CC(C)I.N#Cc1ccc(CBr)cc1F |
| InChI | InChI=1S/C8H5BrFN.C3H7I.C2H6/c9-4-6-1-2-7(5-11)8(10)3-6;1-3(2)4;1-2/h1-3H,4H2;3H,1-2H3;1-2H3 |
| InChIKey | LHYNKKWLQZKPQL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.10 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane?
The IUPAC name of 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane (CID 91540857) is 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane.
What is the SMILES notation for 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane?
The canonical SMILES for 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane is CC.CC(C)I.N#Cc1ccc(CBr)cc1F.
What is the InChIKey of 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane?
The InChIKey is LHYNKKWLQZKPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrFN.C3H7I.C2H6/c9-4-6-1-2-7(5-11)8(10)3-6;1-3(2)4;1-2/h1-3H,4H2;3H,1-2H3;1-2H3.
What are the key properties of 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane?
4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane has a molecular weight of 414.10 g/mol, XLogP of 5.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-2-fluorobenzonitrile;ethane;2-iodopropane is sourced from PubChem (CID 91540857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).