C9H5BrN2 — CID 18779776
4-(bromomethyl)benzene-1,2-dicarbonitrile (PubChem CID 18779776) has the molecular formula C9H5BrN2 and a molecular weight of 221.06 g/mol. Its IUPAC name is 4-(bromomethyl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(bromomethyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 18779776 |
| Molecular Formula | C9H5BrN2 |
| Molecular Weight | 221.06 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | 4-(bromomethyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(CBr)cc1C#N |
| InChI | InChI=1S/C9H5BrN2/c10-4-7-1-2-8(5-11)9(3-7)6-12/h1-3H,4H2 |
| InChIKey | PGVWTUZLUZOGDL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.06 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|