C15H15ClFNO2 — CID 116689764
[2-(3-chloro-2-fluorophenoxy)-6-propyl-4-pyridinyl]methanol (PubChem CID 116689764) has the molecular formula C15H15ClFNO2 and a molecular weight of 295.74 g/mol. Its IUPAC name is [2-(3-chloro-2-fluorophenoxy)-6-propyl-4-pyridinyl]methanol.
| Compound Name | [2-(3-chloro-2-fluorophenoxy)-6-propyl-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 116689764 |
| Molecular Formula | C15H15ClFNO2 |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | [2-(3-chloro-2-fluorophenoxy)-6-propyl-4-pyridinyl]methanol |
| SMILES | CCCc1cc(CO)cc(Oc2cccc(Cl)c2F)n1 |
| InChI | InChI=1S/C15H15ClFNO2/c1-2-4-11-7-10(9-19)8-14(18-11)20-13-6-3-5-12(16)15(13)17/h3,5-8,19H,2,4,9H2,1H3 |
| InChIKey | CDEXUOXDIFCZNI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |