C15H15ClFN3O — CID 116691214
6-(3-chloro-2-fluorophenoxy)-2-cyclopropyl-N-ethylpyrimidin-4-amine (PubChem CID 116691214) has the molecular formula C15H15ClFN3O and a molecular weight of 307.76 g/mol. Its IUPAC name is 6-(3-chloro-2-fluorophenoxy)-2-cyclopropyl-N-ethylpyrimidin-4-amine.
| Compound Name | 6-(3-chloro-2-fluorophenoxy)-2-cyclopropyl-N-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116691214 |
| Molecular Formula | C15H15ClFN3O |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 6-(3-chloro-2-fluorophenoxy)-2-cyclopropyl-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1cc(Oc2cccc(Cl)c2F)nc(C2CC2)n1 |
| InChI | InChI=1S/C15H15ClFN3O/c1-2-18-12-8-13(20-15(19-12)9-6-7-9)21-11-5-3-4-10(16)14(11)17/h3-5,8-9H,2,6-7H2,1H3,(H,18,19,20) |
| InChIKey | IWIOXRCSVFMHRI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |