C15H15ClFN3 — CID 114488701
2-(3-chloro-2-fluorophenyl)-6-cyclopropyl-N-ethylpyrimidin-4-amine (PubChem CID 114488701) has the molecular formula C15H15ClFN3 and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-6-cyclopropyl-N-ethylpyrimidin-4-amine.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-6-cyclopropyl-N-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114488701 |
| Molecular Formula | C15H15ClFN3 |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-6-cyclopropyl-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1cc(C2CC2)nc(-c2cccc(Cl)c2F)n1 |
| InChI | InChI=1S/C15H15ClFN3/c1-2-18-13-8-12(9-6-7-9)19-15(20-13)10-4-3-5-11(16)14(10)17/h3-5,8-9H,2,6-7H2,1H3,(H,18,19,20) |
| InChIKey | FBLIOTCAWBFHNV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |