C13H8Cl3FO2 — CID 106530101
[3-fluoro-5-(2,4,5-trichlorophenoxy)phenyl]methanol (PubChem CID 106530101) has the molecular formula C13H8Cl3FO2 and a molecular weight of 321.56 g/mol. Its IUPAC name is [3-fluoro-5-(2,4,5-trichlorophenoxy)phenyl]methanol.
| Compound Name | [3-fluoro-5-(2,4,5-trichlorophenoxy)phenyl]methanol |
|---|---|
| PubChem CID | 106530101 |
| Molecular Formula | C13H8Cl3FO2 |
| Molecular Weight | 321.56 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | [3-fluoro-5-(2,4,5-trichlorophenoxy)phenyl]methanol |
| SMILES | OCc1cc(F)cc(Oc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H8Cl3FO2/c14-10-4-12(16)13(5-11(10)15)19-9-2-7(6-18)1-8(17)3-9/h1-5,18H,6H2 |
| InChIKey | FVEDJQNEOMXPKA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|