C13H7Cl4FO — CID 106530586
1,2,4-trichloro-5-[3-(chloromethyl)-5-fluorophenoxy]benzene (PubChem CID 106530586) has the molecular formula C13H7Cl4FO and a molecular weight of 340.01 g/mol. Its IUPAC name is 1,2,4-trichloro-5-[3-(chloromethyl)-5-fluorophenoxy]benzene.
| Compound Name | 1,2,4-trichloro-5-[3-(chloromethyl)-5-fluorophenoxy]benzene |
|---|---|
| PubChem CID | 106530586 |
| Molecular Formula | C13H7Cl4FO |
| Molecular Weight | 340.01 g/mol |
| Exact Mass | 337.92 |
| IUPAC Name | 1,2,4-trichloro-5-[3-(chloromethyl)-5-fluorophenoxy]benzene |
| SMILES | Fc1cc(CCl)cc(Oc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H7Cl4FO/c14-6-7-1-8(18)3-9(2-7)19-13-5-11(16)10(15)4-12(13)17/h1-5H,6H2 |
| InChIKey | GERSHCBENFMZJB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.01 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|