C12H7BrCl3NO — CID 107660062
2-(4-bromo-2,5-dichlorophenoxy)-4-(chloromethyl)pyridine (PubChem CID 107660062) has the molecular formula C12H7BrCl3NO and a molecular weight of 367.46 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dichlorophenoxy)-4-(chloromethyl)pyridine.
| Compound Name | 2-(4-bromo-2,5-dichlorophenoxy)-4-(chloromethyl)pyridine |
|---|---|
| PubChem CID | 107660062 |
| Molecular Formula | C12H7BrCl3NO |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 364.88 |
| IUPAC Name | 2-(4-bromo-2,5-dichlorophenoxy)-4-(chloromethyl)pyridine |
| SMILES | ClCc1ccnc(Oc2cc(Cl)c(Br)cc2Cl)c1 |
| InChI | InChI=1S/C12H7BrCl3NO/c13-8-4-10(16)11(5-9(8)15)18-12-3-7(6-14)1-2-17-12/h1-5H,6H2 |
| InChIKey | WETNGROVUYGTLZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|