C10H6F3N3O — CID 80862564
4-(2,4-difluorophenoxy)-5-fluoropyrimidin-2-amine (PubChem CID 80862564) has the molecular formula C10H6F3N3O and a molecular weight of 241.17 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-5-fluoropyrimidin-2-amine.
| Compound Name | 4-(2,4-difluorophenoxy)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80862564 |
| Molecular Formula | C10H6F3N3O |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-5-fluoropyrimidin-2-amine |
| SMILES | Nc1ncc(F)c(Oc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C10H6F3N3O/c11-5-1-2-8(6(12)3-5)17-9-7(13)4-15-10(14)16-9/h1-4H,(H2,14,15,16) |
| InChIKey | CARZMMREXPZWRK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |