C11H6Cl3N3O3 — CID 107499651
2-chloro-4-(4,5-dichloro-2-nitrophenoxy)-5-methylpyrimidine (PubChem CID 107499651) has the molecular formula C11H6Cl3N3O3 and a molecular weight of 334.55 g/mol. Its IUPAC name is 2-chloro-4-(4,5-dichloro-2-nitrophenoxy)-5-methylpyrimidine.
| Compound Name | 2-chloro-4-(4,5-dichloro-2-nitrophenoxy)-5-methylpyrimidine |
|---|---|
| PubChem CID | 107499651 |
| Molecular Formula | C11H6Cl3N3O3 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | 2-chloro-4-(4,5-dichloro-2-nitrophenoxy)-5-methylpyrimidine |
| SMILES | Cc1cnc(Cl)nc1Oc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H6Cl3N3O3/c1-5-4-15-11(14)16-10(5)20-9-3-7(13)6(12)2-8(9)17(18)19/h2-4H,1H3 |
| InChIKey | JOHNTCUKGYDGNH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|