C11H6BrCl2N3O4 — CID 107501354
5-bromo-2-(4,5-dichloro-2-nitrophenoxy)-4-methoxypyrimidine (PubChem CID 107501354) has the molecular formula C11H6BrCl2N3O4 and a molecular weight of 395.00 g/mol. Its IUPAC name is 5-bromo-2-(4,5-dichloro-2-nitrophenoxy)-4-methoxypyrimidine.
| Compound Name | 5-bromo-2-(4,5-dichloro-2-nitrophenoxy)-4-methoxypyrimidine |
|---|---|
| PubChem CID | 107501354 |
| Molecular Formula | C11H6BrCl2N3O4 |
| Molecular Weight | 395.00 g/mol |
| Exact Mass | 392.89 |
| IUPAC Name | 5-bromo-2-(4,5-dichloro-2-nitrophenoxy)-4-methoxypyrimidine |
| SMILES | COc1nc(Oc2cc(Cl)c(Cl)cc2[N+](=O)[O-])ncc1Br |
| InChI | InChI=1S/C11H6BrCl2N3O4/c1-20-10-5(12)4-15-11(16-10)21-9-3-7(14)6(13)2-8(9)17(18)19/h2-4H,1H3 |
| InChIKey | DNSNSSFTNXBETI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.00 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|