C9H2Cl4N4O3 — CID 107499610
2,4-dichloro-6-(4,5-dichloro-2-nitrophenoxy)-1,3,5-triazine (PubChem CID 107499610) has the molecular formula C9H2Cl4N4O3 and a molecular weight of 355.95 g/mol. Its IUPAC name is 2,4-dichloro-6-(4,5-dichloro-2-nitrophenoxy)-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(4,5-dichloro-2-nitrophenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 107499610 |
| Molecular Formula | C9H2Cl4N4O3 |
| Molecular Weight | 355.95 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | 2,4-dichloro-6-(4,5-dichloro-2-nitrophenoxy)-1,3,5-triazine |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1Oc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C9H2Cl4N4O3/c10-3-1-5(17(18)19)6(2-4(3)11)20-9-15-7(12)14-8(13)16-9/h1-2H |
| InChIKey | GPLWPVBOGJQOTK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.95 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|