C10H5ClN6O3 — CID 80872949
4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)oxy]-3-nitrobenzonitrile (PubChem CID 80872949) has the molecular formula C10H5ClN6O3 and a molecular weight of 292.64 g/mol. Its IUPAC name is 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)oxy]-3-nitrobenzonitrile.
| Compound Name | 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)oxy]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 80872949 |
| Molecular Formula | C10H5ClN6O3 |
| Molecular Weight | 292.64 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)oxy]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(Oc2nc(N)nc(Cl)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H5ClN6O3/c11-8-14-9(13)16-10(15-8)20-7-2-1-5(4-12)3-6(7)17(18)19/h1-3H,(H2,13,14,15,16) |
| InChIKey | BTNNWSHFLNNJHW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.64 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|