C12H4Cl3N3O3 — CID 102749640
3-nitro-4-[(3,5,6-trichloro-2-pyridinyl)oxy]benzonitrile (PubChem CID 102749640) has the molecular formula C12H4Cl3N3O3 and a molecular weight of 344.54 g/mol. Its IUPAC name is 3-nitro-4-[(3,5,6-trichloro-2-pyridinyl)oxy]benzonitrile.
| Compound Name | 3-nitro-4-[(3,5,6-trichloro-2-pyridinyl)oxy]benzonitrile |
|---|---|
| PubChem CID | 102749640 |
| Molecular Formula | C12H4Cl3N3O3 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | 3-nitro-4-[(3,5,6-trichloro-2-pyridinyl)oxy]benzonitrile |
| SMILES | N#Cc1ccc(Oc2nc(Cl)c(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H4Cl3N3O3/c13-7-4-8(14)12(17-11(7)15)21-10-2-1-6(5-16)3-9(10)18(19)20/h1-4H |
| InChIKey | LGORFBPDITWGEO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|