C13H7Cl3N2O2 — CID 102749502
3-methoxy-4-[(3,5,6-trichloro-2-pyridinyl)oxy]benzonitrile (PubChem CID 102749502) has the molecular formula C13H7Cl3N2O2 and a molecular weight of 329.57 g/mol. Its IUPAC name is 3-methoxy-4-[(3,5,6-trichloro-2-pyridinyl)oxy]benzonitrile.
| Compound Name | 3-methoxy-4-[(3,5,6-trichloro-2-pyridinyl)oxy]benzonitrile |
|---|---|
| PubChem CID | 102749502 |
| Molecular Formula | C13H7Cl3N2O2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 3-methoxy-4-[(3,5,6-trichloro-2-pyridinyl)oxy]benzonitrile |
| SMILES | COc1cc(C#N)ccc1Oc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl3N2O2/c1-19-11-4-7(6-17)2-3-10(11)20-13-9(15)5-8(14)12(16)18-13/h2-5H,1H3 |
| InChIKey | VZBCQFRCULKMJZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|