C11H7BrF2N4O3 — CID 80880025
5-bromo-4-(2,5-difluoro-4-nitrophenoxy)-N-methylpyrimidin-2-amine (PubChem CID 80880025) has the molecular formula C11H7BrF2N4O3 and a molecular weight of 361.10 g/mol. Its IUPAC name is 5-bromo-4-(2,5-difluoro-4-nitrophenoxy)-N-methylpyrimidin-2-amine.
| Compound Name | 5-bromo-4-(2,5-difluoro-4-nitrophenoxy)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80880025 |
| Molecular Formula | C11H7BrF2N4O3 |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 5-bromo-4-(2,5-difluoro-4-nitrophenoxy)-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(Br)c(Oc2cc(F)c([N+](=O)[O-])cc2F)n1 |
| InChI | InChI=1S/C11H7BrF2N4O3/c1-15-11-16-4-5(12)10(17-11)21-9-3-6(13)8(18(19)20)2-7(9)14/h2-4H,1H3,(H,15,16,17) |
| InChIKey | VIBFWAZEIDONGQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|