C11H4Cl3FN2O3 — CID 79733335
5-chloro-2-(2,6-dichloro-4-nitrophenoxy)-3-fluoropyridine (PubChem CID 79733335) has the molecular formula C11H4Cl3FN2O3 and a molecular weight of 337.52 g/mol. Its IUPAC name is 5-chloro-2-(2,6-dichloro-4-nitrophenoxy)-3-fluoropyridine.
| Compound Name | 5-chloro-2-(2,6-dichloro-4-nitrophenoxy)-3-fluoropyridine |
|---|---|
| PubChem CID | 79733335 |
| Molecular Formula | C11H4Cl3FN2O3 |
| Molecular Weight | 337.52 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | 5-chloro-2-(2,6-dichloro-4-nitrophenoxy)-3-fluoropyridine |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Oc2ncc(Cl)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C11H4Cl3FN2O3/c12-5-1-9(15)11(16-4-5)20-10-7(13)2-6(17(18)19)3-8(10)14/h1-4H |
| InChIKey | PRESLBPTKGOFOE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|