C14H5Cl2F2N3O4 — CID 169146559
4-(2,6-dichloro-4-nitrophenoxy)-5,8-difluoro-2H-phthalazin-1-one (PubChem CID 169146559) has the molecular formula C14H5Cl2F2N3O4 and a molecular weight of 388.11 g/mol. Its IUPAC name is 4-(2,6-dichloro-4-nitrophenoxy)-5,8-difluoro-2H-phthalazin-1-one.
| Compound Name | 4-(2,6-dichloro-4-nitrophenoxy)-5,8-difluoro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 169146559 |
| Molecular Formula | C14H5Cl2F2N3O4 |
| Molecular Weight | 388.11 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 4-(2,6-dichloro-4-nitrophenoxy)-5,8-difluoro-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)c2c(F)ccc(F)c12 |
| InChI | InChI=1S/C14H5Cl2F2N3O4/c15-6-3-5(21(23)24)4-7(16)12(6)25-14-11-9(18)2-1-8(17)10(11)13(22)19-20-14/h1-4H,(H,19,22) |
| InChIKey | XDDJWBKABCSICJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.11 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|