C17H11Cl2FN2O4 — CID 163293831
5-(2,6-dichloro-4-nitrophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclobutane]-2-one (PubChem CID 163293831) has the molecular formula C17H11Cl2FN2O4 and a molecular weight of 397.19 g/mol. Its IUPAC name is 5-(2,6-dichloro-4-nitrophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclobutane]-2-one.
| Compound Name | 5-(2,6-dichloro-4-nitrophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclobutane]-2-one |
|---|---|
| PubChem CID | 163293831 |
| Molecular Formula | C17H11Cl2FN2O4 |
| Molecular Weight | 397.19 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 5-(2,6-dichloro-4-nitrophenoxy)-4-fluorospiro[1H-indole-3,1'-cyclobutane]-2-one |
| SMILES | O=C1Nc2ccc(Oc3c(Cl)cc([N+](=O)[O-])cc3Cl)c(F)c2C12CCC2 |
| InChI | InChI=1S/C17H11Cl2FN2O4/c18-9-6-8(22(24)25)7-10(19)15(9)26-12-3-2-11-13(14(12)20)17(4-1-5-17)16(23)21-11/h2-3,6-7H,1,4-5H2,(H,21,23) |
| InChIKey | FYXRVXAZHAEAQZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.19 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|