C13H8BrCl2NO4 — CID 106891273
2-(2-bromo-4-methoxyphenoxy)-1,3-dichloro-5-nitrobenzene (PubChem CID 106891273) has the molecular formula C13H8BrCl2NO4 and a molecular weight of 393.02 g/mol. Its IUPAC name is 2-(2-bromo-4-methoxyphenoxy)-1,3-dichloro-5-nitrobenzene.
| Compound Name | 2-(2-bromo-4-methoxyphenoxy)-1,3-dichloro-5-nitrobenzene |
|---|---|
| PubChem CID | 106891273 |
| Molecular Formula | C13H8BrCl2NO4 |
| Molecular Weight | 393.02 g/mol |
| Exact Mass | 390.90 |
| IUPAC Name | 2-(2-bromo-4-methoxyphenoxy)-1,3-dichloro-5-nitrobenzene |
| SMILES | COc1ccc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C13H8BrCl2NO4/c1-20-8-2-3-12(9(14)6-8)21-13-10(15)4-7(17(18)19)5-11(13)16/h2-6H,1H3 |
| InChIKey | IQOMPXXEPWPZIU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|