C20H14Cl3NO4 — CID 10320941
1,3-dichloro-2-[3-[(4-chlorophenyl)methyl]-4-methoxyphenoxy]-5-nitrobenzene (PubChem CID 10320941) has the molecular formula C20H14Cl3NO4 and a molecular weight of 438.69 g/mol. Its IUPAC name is 1,3-dichloro-2-[3-[(4-chlorophenyl)methyl]-4-methoxyphenoxy]-5-nitrobenzene.
| Compound Name | 1,3-dichloro-2-[3-[(4-chlorophenyl)methyl]-4-methoxyphenoxy]-5-nitrobenzene |
|---|---|
| PubChem CID | 10320941 |
| Molecular Formula | C20H14Cl3NO4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 1,3-dichloro-2-[3-[(4-chlorophenyl)methyl]-4-methoxyphenoxy]-5-nitrobenzene |
| SMILES | COc1ccc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)cc1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14Cl3NO4/c1-27-19-7-6-16(9-13(19)8-12-2-4-14(21)5-3-12)28-20-17(22)10-15(24(25)26)11-18(20)23/h2-7,9-11H,8H2,1H3 |
| InChIKey | KNMXLQKHXWNHKK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|