C13H9Cl2NO6S — CID 22344879
5-(2,6-dichloro-4-nitrophenoxy)-2-methoxybenzenesulfinic acid (PubChem CID 22344879) has the molecular formula C13H9Cl2NO6S and a molecular weight of 378.19 g/mol. Its IUPAC name is 5-(2,6-dichloro-4-nitrophenoxy)-2-methoxybenzenesulfinic acid.
| Compound Name | 5-(2,6-dichloro-4-nitrophenoxy)-2-methoxybenzenesulfinic acid |
|---|---|
| PubChem CID | 22344879 |
| Molecular Formula | C13H9Cl2NO6S |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 5-(2,6-dichloro-4-nitrophenoxy)-2-methoxybenzenesulfinic acid |
| SMILES | COc1ccc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)cc1S(=O)O |
| InChI | InChI=1S/C13H9Cl2NO6S/c1-21-11-3-2-8(6-12(11)23(19)20)22-13-9(14)4-7(16(17)18)5-10(13)15/h2-6H,1H3,(H,19,20) |
| InChIKey | OJSIHXSNXHTTGR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|