C13H8Cl3NO6S — CID 15541442
5-(2,6-dichloro-4-nitrophenoxy)-2-methoxybenzenesulfonyl chloride (PubChem CID 15541442) has the molecular formula C13H8Cl3NO6S and a molecular weight of 412.63 g/mol. Its IUPAC name is 5-(2,6-dichloro-4-nitrophenoxy)-2-methoxybenzenesulfonyl chloride.
| Compound Name | 5-(2,6-dichloro-4-nitrophenoxy)-2-methoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 15541442 |
| Molecular Formula | C13H8Cl3NO6S |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | 5-(2,6-dichloro-4-nitrophenoxy)-2-methoxybenzenesulfonyl chloride |
| SMILES | COc1ccc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H8Cl3NO6S/c1-22-11-3-2-8(6-12(11)24(16,20)21)23-13-9(14)4-7(17(18)19)5-10(13)15/h2-6H,1H3 |
| InChIKey | XAJWWFQUDSZFHW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|