C13H8Cl3NO5S — CID 59982347
1,3-dichloro-2-(2-chloro-4-nitrophenoxy)-5-methylsulfonylbenzene (PubChem CID 59982347) has the molecular formula C13H8Cl3NO5S and a molecular weight of 396.64 g/mol. Its IUPAC name is 1,3-dichloro-2-(2-chloro-4-nitrophenoxy)-5-methylsulfonylbenzene.
| Compound Name | 1,3-dichloro-2-(2-chloro-4-nitrophenoxy)-5-methylsulfonylbenzene |
|---|---|
| PubChem CID | 59982347 |
| Molecular Formula | C13H8Cl3NO5S |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 1,3-dichloro-2-(2-chloro-4-nitrophenoxy)-5-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1cc(Cl)c(Oc2ccc([N+](=O)[O-])cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl3NO5S/c1-23(20,21)8-5-10(15)13(11(16)6-8)22-12-3-2-7(17(18)19)4-9(12)14/h2-6H,1H3 |
| InChIKey | PRFNULZVKPRMIZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|