C18H19Cl3N6O6S — CID 59982417
5-(diaminomethylideneamino)-2-[[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylamino]pentanamide (PubChem CID 59982417) has the molecular formula C18H19Cl3N6O6S and a molecular weight of 553.81 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylamino]pentanamide.
| Compound Name | 5-(diaminomethylideneamino)-2-[[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 59982417 |
| Molecular Formula | C18H19Cl3N6O6S |
| Molecular Weight | 553.81 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylamino]pentanamide |
| SMILES | NC(=O)C(CCCN=C(N)N)NS(=O)(=O)c1cc(Cl)c(Oc2ccc([N+](=O)[O-])cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H19Cl3N6O6S/c19-11-6-9(27(29)30)3-4-15(11)33-16-12(20)7-10(8-13(16)21)34(31,32)26-14(17(22)28)2-1-5-25-18(23)24/h3-4,6-8,14,26H,1-2,5H2,(H2,22,28)(H4,23,24,25) |
| InChIKey | RQRYIJZSTNAEJO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 206.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|