C16H27N5O4S — CID 18645124
(2R)-5-(diaminomethylideneamino)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]pentanamide (PubChem CID 18645124) has the molecular formula C16H27N5O4S and a molecular weight of 385.49 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 18645124 |
| Molecular Formula | C16H27N5O4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]pentanamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N[C@H](CCCN=C(N)N)C(N)=O)c(C)c1C |
| InChI | InChI=1S/C16H27N5O4S/c1-9-8-13(25-4)10(2)11(3)14(9)26(23,24)21-12(15(17)22)6-5-7-20-16(18)19/h8,12,21H,5-7H2,1-4H3,(H2,17,22)(H4,18,19,20)/t12-/m1/s1 |
| InChIKey | RHWQRCGRMYLUMR-GFCCVEGCSA-N |
| XLogP | -0.19 |
| TPSA | 162.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|