C11H25N5O3S — CID 87204173
(2S)-5-(diaminomethylideneamino)-2-(pentylsulfonylamino)pentanamide (PubChem CID 87204173) has the molecular formula C11H25N5O3S and a molecular weight of 307.42 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-(pentylsulfonylamino)pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-(pentylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 87204173 |
| Molecular Formula | C11H25N5O3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(pentylsulfonylamino)pentanamide |
| SMILES | CCCCCS(=O)(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C11H25N5O3S/c1-2-3-4-8-20(18,19)16-9(10(12)17)6-5-7-15-11(13)14/h9,16H,2-8H2,1H3,(H2,12,17)(H4,13,14,15)/t9-/m0/s1 |
| InChIKey | SKOWVTGBYGDLLW-VIFPVBQESA-N |
| XLogP | -1.00 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|