C11H24N4O2 — CID 87921702
(2S)-5-(diaminomethylideneamino)-2-(pentylamino)pentanoic acid (PubChem CID 87921702) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-(pentylamino)pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-(pentylamino)pentanoic acid |
|---|---|
| PubChem CID | 87921702 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(pentylamino)pentanoic acid |
| SMILES | CCCCCN[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C11H24N4O2/c1-2-3-4-7-14-9(10(16)17)6-5-8-15-11(12)13/h9,14H,2-8H2,1H3,(H,16,17)(H4,12,13,15)/t9-/m0/s1 |
| InChIKey | SVEMJEOWNPDZRC-VIFPVBQESA-N |
| XLogP | 0.27 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|