C17H25NO7S — CID 3860519
diethyl 2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]propanedioate (PubChem CID 3860519) has the molecular formula C17H25NO7S and a molecular weight of 387.45 g/mol. Its IUPAC name is diethyl 2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]propanedioate.
| Compound Name | diethyl 2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]propanedioate |
|---|---|
| PubChem CID | 3860519 |
| Molecular Formula | C17H25NO7S |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | diethyl 2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]propanedioate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1c(C)cc(OC)c(C)c1C)C(=O)OCC |
| InChI | InChI=1S/C17H25NO7S/c1-7-24-16(19)14(17(20)25-8-2)18-26(21,22)15-10(3)9-13(23-6)11(4)12(15)5/h9,14,18H,7-8H2,1-6H3 |
| InChIKey | VFCIMYIOHGAALX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|