C15H25NO3S — CID 5163002
4-methoxy-2,3,6-trimethyl-N-(2-methylbutyl)benzenesulfonamide (PubChem CID 5163002) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 4-methoxy-2,3,6-trimethyl-N-(2-methylbutyl)benzenesulfonamide.
| Compound Name | 4-methoxy-2,3,6-trimethyl-N-(2-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 5163002 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 4-methoxy-2,3,6-trimethyl-N-(2-methylbutyl)benzenesulfonamide |
| SMILES | CCC(C)CNS(=O)(=O)c1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C15H25NO3S/c1-7-10(2)9-16-20(17,18)15-11(3)8-14(19-6)12(4)13(15)5/h8,10,16H,7,9H2,1-6H3 |
| InChIKey | HVCOQSJHDSNAET-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |