C12H20N2O5S2 — CID 171675227
4-methoxy-2,3,6-trimethyl-N-(2-sulfamoylethyl)benzenesulfonamide (PubChem CID 171675227) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-methoxy-2,3,6-trimethyl-N-(2-sulfamoylethyl)benzenesulfonamide.
| Compound Name | 4-methoxy-2,3,6-trimethyl-N-(2-sulfamoylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 171675227 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-methoxy-2,3,6-trimethyl-N-(2-sulfamoylethyl)benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NCCS(N)(=O)=O)c(C)c1C |
| InChI | InChI=1S/C12H20N2O5S2/c1-8-7-11(19-4)9(2)10(3)12(8)21(17,18)14-5-6-20(13,15)16/h7,14H,5-6H2,1-4H3,(H2,13,15,16) |
| InChIKey | GYANGNGBXDPSEB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |