C11H17NO3S — CID 150791377
(4-methoxy-2,3,6-trimethylphenyl)methanesulfonamide (PubChem CID 150791377) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is (4-methoxy-2,3,6-trimethylphenyl)methanesulfonamide.
| Compound Name | (4-methoxy-2,3,6-trimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 150791377 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (4-methoxy-2,3,6-trimethylphenyl)methanesulfonamide |
| SMILES | COc1cc(C)c(CS(N)(=O)=O)c(C)c1C |
| InChI | InChI=1S/C11H17NO3S/c1-7-5-11(15-4)9(3)8(2)10(7)6-16(12,13)14/h5H,6H2,1-4H3,(H2,12,13,14) |
| InChIKey | KDXRADPFHXAVJF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |