C14H18O3 — CID 116866294
2-[(4-methoxy-2,3,6-trimethylphenyl)methyl]prop-2-enoic acid (PubChem CID 116866294) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-[(4-methoxy-2,3,6-trimethylphenyl)methyl]prop-2-enoic acid.
| Compound Name | 2-[(4-methoxy-2,3,6-trimethylphenyl)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116866294 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-[(4-methoxy-2,3,6-trimethylphenyl)methyl]prop-2-enoic acid |
| SMILES | C=C(Cc1c(C)cc(OC)c(C)c1C)C(=O)O |
| InChI | InChI=1S/C14H18O3/c1-8-7-13(17-5)11(4)10(3)12(8)6-9(2)14(15)16/h7H,2,6H2,1,3-5H3,(H,15,16) |
| InChIKey | IKXPMJNDGHYEAR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|